| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:40:58 UTC |
|---|
| Update Date | 2025-03-21 17:58:55 UTC |
|---|
| HMDB ID | HMDB0035914 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00017486 |
|---|
| Name | Aflatoxin P1 |
|---|
| Frequency | 241.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H10O6 |
|---|
| Molecular Mass | 298.0477 |
|---|
| SMILES | O=C1CCc2c1c(=O)oc1c3c(cc(O)c21)OC1OC=CC31 |
|---|
| InChI Key | NRCXNPKDOMYPPJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | furanocoumarins |
|---|
| Direct Parent | angular furanocoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsacetalsaryl alkyl ketonesbenzenoidscoumaransdihydrofuransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | aryl alkyl ketone1-benzopyran1-hydroxy-2-unsubstituted benzenoidketonelactoneorganic oxideacetalaromatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundcoumarandihydrofuranbenzopyranheteroaromatic compoundangular furanocoumarinoxacycleorganic oxygen compoundpyranhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
