DeepMet

Record Information
HMDB Status	expected
Creation Date	2024-02-20 23:41:05 UTC
Update Date	2025-03-21 17:58:56 UTC
HMDB ID	HMDB0029119
Metabolite Identification
DeepMet ID	DMID00017732
Name	Tyrosyl-Gamma-glutamate
Frequency	243.8
Structure
Chemical Formula	C₁₄H₁₉N₃O₅
Molecular Mass	309.1325
SMILES	NC(CCC(=O)NC(=O)C(N)Cc1ccc(O)cc1)C(=O)O
InChI Key	NHXCEHCKISFORA-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	tyrosine and derivatives
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids alpha amino acid amides alpha amino acids amphetamines and derivatives benzene and substituted derivatives carbonyl compounds carboxylic acids dicarboximides glutamine and derivatives hydrocarbon derivatives monoalkylamines monocarboxylic acids and derivatives n-acyl amines n-unsubstituted carboxylic acid imides organic oxides organonitrogen compounds organopnictogen compounds phenylalanine and derivatives
Substituents	monocyclic benzene moiety carbonyl group carboxylic acid glutamine or derivatives 1-hydroxy-2-unsubstituted benzenoid carboxylic acid imide, n-unsubstituted organic oxide organonitrogen compound alpha-amino acid organopnictogen compound dicarboximide amphetamine or derivatives tyrosine or derivatives alpha-amino acid amide n-acyl-amine carboxylic acid imide aromatic homomonocyclic compound monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound phenol hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound organooxygen compound

Showing information for DMID00017732