| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:09 UTC |
|---|
| Update Date | 2025-03-21 17:58:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00017887 |
|---|
| Frequency | 233.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H23NO2 |
|---|
| Molecular Mass | 249.1729 |
|---|
| SMILES | CC(C)(C)c1cc(C(N)=O)cc(C(C)(C)C)c1O |
|---|
| InChI Key | DGZQOKRGJUFPQC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsphenolsphenylpropanesprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidebenzoylcarboxamide groupcarboxylic acid derivativebenzamidephenylpropanearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
