| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:41:14 UTC |
|---|
| Update Date | 2025-03-21 17:58:59 UTC |
|---|
| HMDB ID | HMDB0243491 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018059 |
|---|
| Name | (2S,3R,4R,5S,6S)-2-(Hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
|---|
| Frequency | 230.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O6 |
|---|
| Molecular Mass | 270.1103 |
|---|
| SMILES | OCC1OC(OCc2ccccc2)C(O)C(O)C1O |
|---|
| InChI Key | GKHCBYYBLTXYEV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compoundmonosaccharideoxacycleacetalsecondary alcoholhydrocarbon derivativebenzenoidoxaneprimary alcoholorganoheterocyclic compound |
|---|
