| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:14 UTC |
|---|
| Update Date | 2025-03-21 17:58:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018064 |
|---|
| Frequency | 288.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H20N4O5 |
|---|
| Molecular Mass | 288.1434 |
|---|
| SMILES | N=C(NCCCC(=O)C(=O)O)NCCCC(N)C(=O)O |
|---|
| InChI Key | CETPQWKGJNTWDD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsalpha-hydroxy ketonesalpha-keto acids and derivativescarboximidamidescarboxylic acidsdicarboxylic acids and derivativesguanidineshydrocarbon derivativesiminesmonoalkylaminesorganic oxidesorganopnictogen compoundsshort-chain keto acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidguanidineimineshort-chain keto acidalpha-hydroxy ketoneketoneorganic oxidearginine or derivativesorganonitrogen compoundalpha-keto acidalpha-amino acidorganopnictogen compoundcarboximidamideorganic oxygen compoundketo aciddicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
