| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:15 UTC |
|---|
| Update Date | 2025-03-21 17:59:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018114 |
|---|
| Frequency | 229.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6O10S |
|---|
| Molecular Mass | 293.9682 |
|---|
| SMILES | O=C(OS(=O)(=O)O)c1cc(O)c(O)c(O)c1C(=O)O |
|---|
| InChI Key | RLJYSMAMGYTSBJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundspyrogallols and derivativessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | sulfuric acid monoestercarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidcarboxylic acid derivativeorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidorganic sulfuric acid or derivativespyrogallol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compounddicarboxylic acid or derivativesphenolhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|
