Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:41:18 UTC |
---|
Update Date | 2025-03-21 17:59:01 UTC |
---|
HMDB ID | HMDB0030090 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00018195 |
---|
Name | Sakuranetin |
---|
Frequency | 228.4 |
---|
Structure | |
---|
Chemical Formula | C16H14O5 |
---|
Molecular Mass | 286.0841 |
---|
SMILES | COc1cc(O)c2c(c1)OC(c1ccc(O)cc1)CC2=O |
---|
InChI Key | DJOJDHGQRNZXQQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | o-methylated flavonoids |
---|
Direct Parent | 7-o-methylated flavonoids |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoidsalkyl aryl ethersanisolesaryl alkyl ketonesbenzene and substituted derivativeschromonesflavanoneshydrocarbon derivativesorganic oxidesoxacyclic compoundsvinylogous acids |
---|
Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanoneflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidechromonearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundanisole4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoid7-methoxyflavonoid-skeletonorganooxygen compoundaryl ketone |
---|