Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:41:18 UTC |
---|
Update Date | 2025-03-21 17:59:01 UTC |
---|
HMDB ID | HMDB0240547 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00018204 |
---|
Name | Naringenin 7-sulfate |
---|
Frequency | 228.3 |
---|
Structure | |
---|
Chemical Formula | C15H12O8S |
---|
Molecular Mass | 352.0253 |
---|
SMILES | O=C1CC(c2ccc(O)cc2)Oc2cc(OS(=O)(=O)O)cc(O)c21 |
---|
InChI Key | LCXKYLMSILXZFG-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | flavans |
---|
Direct Parent | flavanones |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoidsalkyl aryl ethersaryl alkyl ketonesarylsulfatesbenzene and substituted derivativeschromoneshydrocarbon derivativesorganic oxidesoxacyclic compoundssulfuric acid monoestersvinylogous acids |
---|
Substituents | monocyclic benzene moietysulfuric acid monoesteretheraryl alkyl ketone1-benzopyranflavanone1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidechromonearomatic heteropolycyclic compoundchromanearylsulfateorganoheterocyclic compoundbenzopyranorganic sulfuric acid or derivatives5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compound4'-hydroxyflavonoidsulfate-esterphenolhydrocarbon derivativebenzenoidsulfuric acid esterorganooxygen compoundaryl ketone |
---|