| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:41:25 UTC |
|---|
| Update Date | 2025-03-21 17:59:04 UTC |
|---|
| HMDB ID | HMDB0301940 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018492 |
|---|
| Name | 5-O-Methylgenistein |
|---|
| Frequency | 223.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O5 |
|---|
| Molecular Mass | 284.0685 |
|---|
| SMILES | COc1cc(O)cc2occ(-c3ccc(O)cc3)c(=O)c12 |
|---|
| InChI Key | YSINCDVRUMTOPK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous esters |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundisoflavonebenzopyranvinylogous esterheteroaromatic compoundoxacycleorganic oxygen compoundpyrananisolephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
