| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:41:31 UTC |
|---|
| Update Date | 2025-03-21 17:59:05 UTC |
|---|
| HMDB ID | HMDB0130321 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018684 |
|---|
| Name | 3-(4-hydroxy-3-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
|---|
| Frequency | 220.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O6 |
|---|
| Molecular Mass | 302.079 |
|---|
| SMILES | COc1cc(C=CC(=O)c2c(O)cc(O)cc2O)ccc1O |
|---|
| InChI Key | WQWVIIRCVOZVPN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | cinnamylphenols |
|---|
| Direct Parent | cinnamylphenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl aryl ethersalpha,beta-unsaturated ketonesanisolesaryl ketonesbenzoyl derivativeshydrocarbon derivativeshydroxycinnamic acidsmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherbenzoyl1-hydroxy-2-unsubstituted benzenoidmethoxyphenolcinnamylphenolalkyl aryl etheralpha,beta-unsaturated ketonehydroxycinnamic acid or derivativesketonephloroglucinol derivativecinnamic acid or derivativesorganic oxideacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketone |
|---|