Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:41:31 UTC |
---|
Update Date | 2025-03-21 17:59:05 UTC |
---|
HMDB ID | HMDB0130321 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00018684 |
---|
Name | 3-(4-hydroxy-3-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one |
---|
Frequency | 220.9 |
---|
Structure | |
---|
Chemical Formula | C16H14O6 |
---|
Molecular Mass | 302.079 |
---|
SMILES | COc1cc(C=CC(=O)c2c(O)cc(O)cc2O)ccc1O |
---|
InChI Key | WQWVIIRCVOZVPN-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | linear 1,3-diarylpropanoids |
---|
Subclass | cinnamylphenols |
---|
Direct Parent | cinnamylphenols |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl aryl ethersalpha,beta-unsaturated ketonesanisolesaryl ketonesbenzoyl derivativeshydrocarbon derivativeshydroxycinnamic acidsmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundsvinylogous acids |
---|
Substituents | phenol ethermonocyclic benzene moietyetherbenzoyl1-hydroxy-2-unsubstituted benzenoidmethoxyphenolcinnamylphenolalkyl aryl etheralpha,beta-unsaturated ketonehydroxycinnamic acid or derivativesketonephloroglucinol derivativecinnamic acid or derivativesorganic oxideacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketone |
---|