| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:33 UTC |
|---|
| Update Date | 2025-03-21 17:59:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018757 |
|---|
| Frequency | 220.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9NO5S |
|---|
| Molecular Mass | 243.0201 |
|---|
| SMILES | O=S(=O)(O)Oc1ccc2[nH]cc(CO)c2c1 |
|---|
| InChI Key | VGEBIIOSFLHHII-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indole-3-carbinol and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsarylsulfatesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolessulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholalcoholsulfuric acid monoesterorganic sulfuric acid or derivativesazacycleheteroaromatic compoundorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativearylsulfatebenzenoidindole-3-carbinol or derivativesorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
|---|
