| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:33 UTC |
|---|
| Update Date | 2025-03-21 17:59:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018779 |
|---|
| Frequency | 219.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H29ClN2O3 |
|---|
| Molecular Mass | 416.1867 |
|---|
| SMILES | CN(C)C(=O)C(O)(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)c1ccccc1 |
|---|
| InChI Key | AVBAXHJNKMUYOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | phenylpiperidines |
|---|
| Direct Parent | phenylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsamino acids and derivativesaromatic alcoholsaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compoundsphenylacetamidestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundphenylacetamidetertiary aminearyl chloridechlorobenzenealcohol1,3-aminoalcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminearyl halidetertiary alcoholorganic oxygen compoundphenylpiperidinehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
