| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:36 UTC |
|---|
| Update Date | 2025-03-21 17:59:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018881 |
|---|
| Frequency | 218.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N3O8 |
|---|
| Molecular Mass | 293.0859 |
|---|
| SMILES | N=C(NOCCC(O)C(=O)O)NC(CC(=O)O)C(=O)O |
|---|
| InChI Key | UZLBWENIDBIRHN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsalpha hydroxy acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidsguanidineshydrocarbon derivativesiminesmonosaccharidesorganic oxidesorganopnictogen compoundssecondary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidguanidineiminealpha-hydroxy acidmonosaccharidetricarboxylic acid or derivativessaccharideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundalcoholcarboximidamidehydroxy acidorganic oxygen compoundaspartic acid or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
