| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:36 UTC |
|---|
| Update Date | 2025-03-21 17:59:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018887 |
|---|
| Frequency | 218.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H13Cl3O7 |
|---|
| Molecular Mass | 433.9727 |
|---|
| SMILES | O=C(O)C1OC(Oc2cc(Cl)ccc2Oc2ccc(Cl)cc2Cl)C(O)C1O |
|---|
| InChI Key | RZXSZFPRXAHMKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetalsaryl chloridesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdiarylethersdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganochloridesoxacyclic compoundsphenol ethersphenoxy compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundorganochloridemonosaccharidecarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzenebeta-hydroxy acidsaccharideorganic oxideacetalorganoheterocyclic compound1,2-diolaryl chloridechlorobenzenealcoholtetrahydrofuranhydroxy acidaryl halideoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
