| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:37 UTC |
|---|
| Update Date | 2025-03-21 17:59:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018934 |
|---|
| Frequency | 217.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H6O5 |
|---|
| Molecular Mass | 194.0215 |
|---|
| SMILES | O=C(O)C(=O)c1ccccc1C(=O)O |
|---|
| InChI Key | LFLOMAIEONDOLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalpha-keto acids and derivativesaryl ketonesbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | carbonyl groupcarboxylic acidbenzoylcarboxylic acid derivativeketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundketo acidalpha-keto aciddicarboxylic acid or derivativeshydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compoundaryl ketone |
|---|
