| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:39 UTC |
|---|
| Update Date | 2025-03-21 17:59:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00018974 |
|---|
| Frequency | 217.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N4O5 |
|---|
| Molecular Mass | 258.0964 |
|---|
| SMILES | NC(=O)c1cnn(C2OC(CO)C(O)C2O)c1N |
|---|
| InChI Key | ISEWZMIZSXBSTC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrazole ribonucleosides and ribonucleotides |
|---|
| Subclass | pyrazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | pyrazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminesprimary carboxylic acid amidespyrazolessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidearomatic heteromonocyclic compoundamino acid or derivativesmonosaccharidecarboxylic acid derivativepyrazole1-ribofuranosylpyrazolesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundcarboxamide groupoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
