| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:41:42 UTC |
|---|
| Update Date | 2025-03-21 17:59:09 UTC |
|---|
| HMDB ID | HMDB0125440 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019112 |
|---|
| Name | [2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-1-benzopyran-3-yl]oxidanesulfonic acid |
|---|
| Frequency | 215.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O10S |
|---|
| Molecular Mass | 384.0151 |
|---|
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2ccc(O)c(O)c2)C1OS(=O)(=O)O |
|---|
| InChI Key | NCBSZRZCBJNBIZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | sulfated flavonoids |
|---|
| Direct Parent | 3-sulfated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersalkyl sulfatesaryl alkyl ketonesbenzene and substituted derivativeschromonesflavanonolshydrocarbon derivativesorganic oxidesoxacyclic compoundssulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesteretheraryl alkyl ketone1-benzopyranflavanoneflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidechromonearomatic heteropolycyclic compoundalkyl sulfatechromaneorganoheterocyclic compoundbenzopyranorganic sulfuric acid or derivatives3-sulfated flavonoid5-hydroxyflavonoidflavanonol1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidsulfate-esterphenolhydrocarbon derivativebenzenoidsulfuric acid esterorganooxygen compoundaryl ketone |
|---|