| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:43 UTC |
|---|
| Update Date | 2025-03-21 17:59:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019130 |
|---|
| Frequency | 214.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O6 |
|---|
| Molecular Mass | 236.0321 |
|---|
| SMILES | O=C(O)C(=O)CC(=O)c1ccccc1C(=O)O |
|---|
| InChI Key | PJNXNURKJZQEFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalpha-hydroxy ketonesalpha-keto acids and derivativesaryl alkyl ketonesbenzoic acidsbenzoyl derivativesbutyrophenonesdicarboxylic acids and derivativesgamma-keto acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketonebenzoylalpha-hydroxy ketonecarboxylic acid derivativeorganic oxidealpha-keto acid1-carboxy-2-haloaromatic compoundbenzoic acidbenzoic acid or derivativesgamma-keto acidbutyrophenonearomatic homomonocyclic compoundketo aciddicarboxylic acid or derivativeshydrocarbon derivativebenzenoidalkyl-phenylketone |
|---|
