| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:47 UTC |
|---|
| Update Date | 2025-03-21 17:59:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019295 |
|---|
| Frequency | 212.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H14O9 |
|---|
| Molecular Mass | 374.0638 |
|---|
| SMILES | O=C(O)C1OC(Oc2ccc3c(c2)oc(=O)c2cc(O)ccc23)C(O)C1O |
|---|
| InChI Key | MGLSFPNRKKSTGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-benzopyrans1-hydroxy-2-unsubstituted benzenoids2-benzopyransacetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsphenol etherspyranones and derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acid1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativelactonebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneorganoheterocyclic compound1,2-diolalcoholbenzopyrantetrahydrofuranheteroaromatic compoundhydroxy acidisocoumarincoumarinoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyran2-benzopyransecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
