| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:48 UTC |
|---|
| Update Date | 2025-03-21 17:59:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019333 |
|---|
| Frequency | 212.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H2F6O5S |
|---|
| Molecular Mass | 275.9527 |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | HMUGTRCGMCJEMD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | halogenated fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganosulfonic acidssulfonylsthia fatty acids |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesaliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidorganosulfonic acidalpha-halocarboxylic acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganic oxidealkyl halidehalogenated fatty acidalkyl fluorideorganofluoridemonocarboxylic acid or derivativesthia fatty acidsulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
