| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:48 UTC |
|---|
| Update Date | 2025-03-21 17:59:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019348 |
|---|
| Frequency | 211.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10I4O5 |
|---|
| Molecular Mass | 777.6707 |
|---|
| SMILES | O=C(O)C(O)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
|---|
| InChI Key | JEAVLSCJUQYFHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaryl iodidescarbonyl compoundscarboxylic acidsdiarylethershalophenolshydrocarbon derivativesiodobenzenesmonocarboxylic acids and derivativeso-iodophenolsorganic oxidesorganoiodidesphenol ethersphenoxy compoundsphenylpropanoic acidssecondary alcohols |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acid3-phenylpropanoic-acidalpha-hydroxy acidcarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxidealcohol2-iodophenolhydroxy acidaryl halidearomatic homomonocyclic compound2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativearyl iodidehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
