| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:53 UTC |
|---|
| Update Date | 2025-03-21 17:59:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019512 |
|---|
| Frequency | 209.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8N4O3 |
|---|
| Molecular Mass | 184.0596 |
|---|
| SMILES | Cn1c(=O)[nH]c(NC=O)c(N)c1=O |
|---|
| InChI Key | PWGKJJOBPOSDQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-arylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundamino acid or derivativespyrimidonen-arylamidecarboxylic acid derivativepyrimidineorganic oxideorganopnictogen compoundorganoheterocyclic compoundvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeprimary amineamineorganooxygen compound |
|---|