| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:54 UTC |
|---|
| Update Date | 2025-03-21 17:59:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019566 |
|---|
| Frequency | 208.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H40N2O2 |
|---|
| Molecular Mass | 532.309 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | KSHWBOXMSSZWQA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic oxidesorganopnictogen compoundsphenylacetamidespiperidinestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminetertiary alcoholorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
