| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:41:55 UTC |
|---|
| Update Date | 2025-03-21 17:59:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019586 |
|---|
| Frequency | 395.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H4N4O2 |
|---|
| Molecular Mass | 164.0334 |
|---|
| SMILES | O=c1cnc2c(=O)nc[nH]c2[nH]1 |
|---|
| InChI Key | GZSFNZAVQZGNTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrazinespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidelactamazacycleheteroaromatic compoundpyrimidonepteridinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
