| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:41:57 UTC |
|---|
| Update Date | 2025-03-21 17:59:14 UTC |
|---|
| HMDB ID | HMDB0240463 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019666 |
|---|
| Name | 4-Methylgallic acid 3-sulfate |
|---|
| Frequency | 207.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O8S |
|---|
| Molecular Mass | 263.994 |
|---|
| SMILES | COc1c(O)cc(C(=O)O)cc1OS(=O)(=O)O |
|---|
| InChI Key | LMJIEJLSDJBABY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativeshydroxybenzoic acid derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessulfuric acid monoesters |
|---|
| Substituents | phenol ethersulfuric acid monoesterethercarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethercarboxylic acid derivativephenylsulfateorganic oxidearylsulfatebenzoic acidorganic sulfuric acid or derivatives1-hydroxy-4-unsubstituted benzenoidmethoxybenzenehydroxybenzoic acidaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundp-methoxybenzoic acid or derivativesanisolesulfate-esterphenolhydrocarbon derivativephenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
