| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:41:58 UTC |
|---|
| Update Date | 2025-03-21 17:59:14 UTC |
|---|
| HMDB ID | HMDB0247066 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019711 |
|---|
| Name | 6-Formylpterin |
|---|
| Frequency | 261.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H5N5O2 |
|---|
| Molecular Mass | 191.0443 |
|---|
| SMILES | Nc1nc2ncc(C=O)nc2c(=O)[nH]1 |
|---|
| InChI Key | LLJAQDVNMGLRBD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl-aldehydesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazine carboxylic acids and derivativespyrimidones |
|---|
| Substituents | pterinlactamazacycleheteroaromatic compoundpyrimidonealdehydepyrimidineorganic oxidearyl-aldehydeorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundpyrazine carboxylic acid or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
