| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:02 UTC |
|---|
| Update Date | 2025-03-21 17:59:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019836 |
|---|
| Frequency | 205.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12O8S |
|---|
| Molecular Mass | 244.0253 |
|---|
| SMILES | O=S(=O)(O)OC1CC(O)C(O)C(O)C1O |
|---|
| InChI Key | MNIPRHOUQQMOKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatescyclitols and derivativeshydrocarbon derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterorganic sulfuric acid or derivativescyclohexanolcyclitol or derivativescyclic alcoholorganic oxidealkyl sulfatealiphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativesulfuric acid ester |
|---|