| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:04 UTC |
|---|
| Update Date | 2025-03-21 17:59:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019918 |
|---|
| Frequency | 204.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20N2O3 |
|---|
| Molecular Mass | 252.1474 |
|---|
| SMILES | CN(C)CC(O)COc1ccc(CC(N)=O)cc1 |
|---|
| InChI Key | GRZLURFQGLIWHU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalkyl aryl ethersamino acids and derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amidessecondary alcoholstrialkylamines |
|---|
| Substituents | primary carboxylic acid amidephenol ethercarbonyl groupetheramino acid or derivativesalkyl aryl ethercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamidetertiary aminealcohol1,2-aminoalcoholtertiary aliphatic aminecarboxamide grouparomatic homomonocyclic compoundorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|