| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:05 UTC |
|---|
| Update Date | 2025-03-21 17:59:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00019979 |
|---|
| Frequency | 203.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O3 |
|---|
| Molecular Mass | 237.0862 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C1O |
|---|
| InChI Key | YUKWAKMMRXYSTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsoxetanesprimary alcoholsprimary aminespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | pyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamazolen-substituted imidazolealcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compoundoxetanesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
