| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:08 UTC |
|---|
| Update Date | 2025-03-21 17:59:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020056 |
|---|
| Frequency | 202.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O6 |
|---|
| Molecular Mass | 314.079 |
|---|
| SMILES | COc1cc(-c2cc(=O)c3cc(OC)c(O)cc3o2)ccc1O |
|---|
| InChI Key | ONGSIZGYZVYYNI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 6-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids3'-o-methylated flavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersanisoleschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran6-methoxyflavonoid-skeleton1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compoundmethoxybenzene3p-methoxyflavonoid-skeletonoxacycleorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
