| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:09 UTC |
|---|
| Update Date | 2025-03-21 17:59:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020093 |
|---|
| Frequency | 202.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O9P |
|---|
| Molecular Mass | 243.9984 |
|---|
| SMILES | O=C(O)C(O)C(O)C(=O)COP(=O)(O)O |
|---|
| InChI Key | NXJWYBPXTIDUCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | glycerone phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacyloinsalpha hydroxy acids and derivativesalpha-hydroxy ketonesbeta hydroxy acids and derivativesbeta-hydroxy ketonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholsshort-chain keto acids and derivatives |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarboxylic acidalpha-hydroxy acidmonosaccharideshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxide1,2-diolalcoholhydroxy acidglycerone phosphategamma-keto acidmonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphateketo acidacyloinsecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
