| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:10 UTC |
|---|
| Update Date | 2025-03-21 17:59:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020162 |
|---|
| Frequency | 201.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H23N4O9P |
|---|
| Molecular Mass | 470.1203 |
|---|
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)COP(=O)(O)OCC(O)CO)c2cc1C |
|---|
| InChI Key | BNBWNRYTROJPOC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | alloxazines and isoalloxazines |
|---|
| Direct Parent | flavins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsdialkyl phosphatesdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrazinespyrimidonesquinoxalinessecondary alcohols |
|---|
| Substituents | lactampyrimidoneflavinpyrimidineorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholquinoxalinecarbonic acid derivativeazacycleheteroaromatic compounddialkyl phosphateorganic oxygen compoundphosphoric acid esterpyrazinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
