| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:42:14 UTC |
|---|
| Update Date | 2025-03-21 17:59:20 UTC |
|---|
| HMDB ID | HMDB0029147 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020284 |
|---|
| Name | N-gamma-Glutamylglutamine |
|---|
| Frequency | 214.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N3O6 |
|---|
| Molecular Mass | 275.1117 |
|---|
| SMILES | NC(CCC(=O)NC(=O)CCC(N)C(=O)O)C(=O)O |
|---|
| InChI Key | FCWNOQOVMGNKNG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboximidesdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesmonoalkylaminesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidn-acyl-aminecarboxylic acid imidecarboxylic acid imide, n-unsubstitutedorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic aminedicarboximideorganic nitrogen compoundorganooxygen compound |
|---|
