Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:42:15 UTC |
---|
Update Date | 2025-03-21 17:59:21 UTC |
---|
HMDB ID | HMDB0134126 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00020317 |
---|
Name | (2Z)-2-[(4-hydroxyphenyl)methylidene]octanal |
---|
Frequency | 199.6 |
---|
Structure | |
---|
Chemical Formula | C15H20O2 |
---|
Molecular Mass | 232.1463 |
---|
SMILES | CCCCCCC(C=O)=Cc1ccc(O)cc1 |
---|
InChI Key | HRIYIPRVWCEVIT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | cinnamaldehydes |
---|
Subclass | cinnamaldehydes |
---|
Direct Parent | cinnamaldehydes |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaldehydesbenzene and substituted derivativeshydrocarbon derivativesorganic oxides |
---|
Substituents | monocyclic benzene moietycinnamaldehydecarbonyl group1-hydroxy-2-unsubstituted benzenoidaldehydearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|