| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:15 UTC |
|---|
| Update Date | 2025-03-21 17:59:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020327 |
|---|
| Frequency | 199.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O8P |
|---|
| Molecular Mass | 213.9879 |
|---|
| SMILES | O=C(O)C(O)C(=O)COP(=O)(O)O |
|---|
| InChI Key | SMTGVDDLBJESIT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | glycerone phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsacyloinsalpha hydroxy acids and derivativesalpha-hydroxy ketonesbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholsshort-chain keto acids and derivatives |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarboxylic acidalpha-hydroxy acidmonosaccharideshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativebeta-keto acidsaccharideorganic oxidealcoholhydroxy acidglycerone phosphatemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphateketo acidacyloinsecondary alcoholhydrocarbon derivative1,3-dicarbonyl compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
