| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:42:18 UTC |
|---|
| Update Date | 2025-03-21 17:59:21 UTC |
|---|
| HMDB ID | HMDB0002399 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020461 |
|---|
| Name | Cystathionine sulfoxide |
|---|
| Frequency | 197.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14N2O5S |
|---|
| Molecular Mass | 238.0623 |
|---|
| SMILES | NC(CCS(=O)CC(N)C(=O)O)C(=O)O |
|---|
| InChI Key | JNUGGJHCMRWUDV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfinyl compoundssulfoxidesthia fatty acids |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty acidorganosulfur compoundorganic oxidethia fatty acidorganic oxygen compoundsulfinyl compoundorganonitrogen compoundsulfoxidealpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
