| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:21 UTC |
|---|
| Update Date | 2025-03-21 17:59:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020565 |
|---|
| Frequency | 196.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO3 |
|---|
| Molecular Mass | 197.1052 |
|---|
| SMILES | CC(=O)OC1CC2C3OC3C(C1)N2C |
|---|
| InChI Key | STVHCCDCQPVOGZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | oxazinanes |
|---|
| Subclass | morpholines |
|---|
| Direct Parent | morpholines |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acid estersdialkyl ethersepoxideshydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsoxacyclic compoundspiperidinestrialkylamines |
|---|
| Substituents | carbonyl groupetheramino acid or derivativescarboxylic acid derivativedialkyl etheraliphatic heteropolycyclic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundpyrrolidinepiperidinetertiary amineazacyclen-alkylpyrrolidinetertiary aliphatic amineoxiraneoxacyclemorpholinemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|