| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:27 UTC |
|---|
| Update Date | 2025-03-21 17:59:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020808 |
|---|
| Frequency | 193.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N5O8P |
|---|
| Molecular Mass | 375.058 |
|---|
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC3C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | NUQRNQGKJTUOAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsoxanesprimary aminespurines and purine derivativespyrimidonessecondary alcoholsvinylogous amides |
|---|
| Substituents | lactampyrimidoneimidazopyrimidinepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundazole1,2-dioln-substituted imidazolealcoholvinylogous amideazacycleheteroaromatic compoundoxacyclesecondary alcoholhexose phosphatehypoxanthinehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeamine |
|---|
