| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:30 UTC |
|---|
| Update Date | 2025-03-21 17:59:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020899 |
|---|
| Frequency | 192.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H23NO3 |
|---|
| Molecular Mass | 253.1678 |
|---|
| SMILES | COCCc1ccc(OCC(O)CN(C)C)cc1 |
|---|
| InChI Key | LQYQAOSISMFMOA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalkyl aryl ethersdialkyl ethershydrocarbon derivativesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcoholstrialkylamines |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietyether1,2-aminoalcoholtertiary aliphatic aminealkyl aryl etherdialkyl etheraromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativetyrosol derivativeorganic nitrogen compoundphenoxy compoundaminetertiary amineorganooxygen compound |
|---|
