| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:42:32 UTC |
|---|
| Update Date | 2025-03-21 17:59:26 UTC |
|---|
| HMDB ID | HMDB0011725 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00020977 |
|---|
| Name | 5-Sulfosalicylic acid |
|---|
| Frequency | 191.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O6S |
|---|
| Molecular Mass | 217.9885 |
|---|
| SMILES | O=C(O)c1cc(S(=O)(=O)O)ccc1O |
|---|
| InChI Key | YCPXWRQRBFJBPZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonic acids and derivatives |
|---|
| Direct Parent | 3-sulfobenzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidssalicylic acidssulfonylssulfosalicylic acids and derivativesvinylogous acids |
|---|
| Substituents | organosulfonic acid or derivativescarboxylic acidorganosulfonic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidorganosulfur compoundcarboxylic acid derivativeorganic oxide3-sulfobenzoic acid1-carboxy-2-haloaromatic compoundbenzoic acidsulfosalicylic acid or derivativesbenzenesulfonyl group1-sulfo,2-unsubstituted aromatic compoundbenzoic acid or derivativeshydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativessulfonylorganic oxygen compoundarylsulfonic acid or derivativessalicylic acid or derivativesorganic sulfonic acid or derivativesphenolhydrocarbon derivativeorganooxygen compound |
|---|
