| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:33 UTC |
|---|
| Update Date | 2025-03-21 17:59:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00021014 |
|---|
| Frequency | 191.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H28N2O |
|---|
| Molecular Mass | 336.2202 |
|---|
| SMILES | CN(C)C(=O)C(CCN1CCCC1)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | DHWWPFNGASZPLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsphenylacetamidestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpyrrolidinephenylacetamidetertiary amineorganoheterocyclic compoundazacyclen-alkylpyrrolidinetertiary aliphatic aminecarboxamide groupn-acyl-amineorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|