| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:42:38 UTC |
|---|
| Update Date | 2025-03-21 17:59:28 UTC |
|---|
| HMDB ID | HMDB0126034 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00021207 |
|---|
| Name | 2-(3,5-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one |
|---|
| Frequency | 189.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O6 |
|---|
| Molecular Mass | 286.0477 |
|---|
| SMILES | O=c1cc(-c2cc(O)cc(O)c2)oc2cc(O)cc(O)c12 |
|---|
| InChI Key | LRDGATPGVJTWLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 5-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids7-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesresorcinolsvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidresorcinolorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
