| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:39 UTC |
|---|
| Update Date | 2025-03-21 17:59:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00021258 |
|---|
| Frequency | 188.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H23N3O5 |
|---|
| Molecular Mass | 349.1638 |
|---|
| SMILES | CN1CCN(c2ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc2)CC1 |
|---|
| InChI Key | PMMOTZRXFAXWEQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsaminobenzamidesaniline and substituted anilinesazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkylarylaminesdicarboxylic acids and derivativeshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsn-arylpiperazinesn-methylpiperazinesorganic oxidesorganopnictogen compoundsphenylpiperazinessecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidbenzoylbenzamideorganic oxidepiperazinetertiary aliphatic/aromatic amineorganonitrogen compoundalpha-amino acidorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary amineorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesazacyclen-acyl-alpha-amino acidhippuric acid or derivativesaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminen-methylpiperazinebenzoic acid or derivativesglutamic acid or derivativescarboxamide groupaminobenzamidephenylpiperazinesecondary carboxylic acid amideorganic oxygen compound1,4-diazinanedicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|