Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:42:41 UTC |
---|
Update Date | 2025-03-21 17:59:29 UTC |
---|
HMDB ID | HMDB0245544 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00021312 |
---|
Name | 2',3'-Dideoxyadenosine |
---|
Frequency | 188.0 |
---|
Structure | |
---|
Chemical Formula | C10H13N5O2 |
---|
Molecular Mass | 235.1069 |
---|
SMILES | Nc1ncnc2c1ncn2C1CCC(CO)O1 |
---|
InChI Key | WVXRAFOPTSTNLL-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | imidazopyrimidines |
---|
Subclass | purines and purine derivatives |
---|
Direct Parent | purines and purine derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrimidines and pyrimidine derivativestetrahydrofurans |
---|
Substituents | alcoholazacycletetrahydrofuranheteroaromatic compoundpyrimidineoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compoundazolen-substituted imidazole |
---|