| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:41 UTC |
|---|
| Update Date | 2025-03-21 17:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00021333 |
|---|
| Frequency | 187.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H19NO |
|---|
| Molecular Mass | 241.1467 |
|---|
| SMILES | CN(C)C(c1ccccc1)C(O)c1ccccc1 |
|---|
| InChI Key | MLJRRPFUCGOHPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaralkylaminesaromatic alcoholsbenzene and substituted derivativeshydrocarbon derivativesorganopnictogen compoundssecondary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moiety1,2-aminoalcoholtertiary aliphatic aminearalkylaminearomatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compoundstilbene |
|---|
