Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:42:42 UTC |
---|
Update Date | 2025-03-21 17:59:29 UTC |
---|
HMDB ID | HMDB0029009 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00021347 |
---|
Name | Phenylalanyl-Gamma-glutamate |
---|
Frequency | 187.7 |
---|
Structure | |
---|
Chemical Formula | C14H19N3O4 |
---|
Molecular Mass | 293.1376 |
---|
SMILES | NC(CCC(=O)NC(=O)C(N)Cc1ccccc1)C(=O)O |
---|
InChI Key | XWHWNYMBZXDFRP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | phenylalanine and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdicarboximidesglutamine and derivativeshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidglutamine or derivativescarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideamphetamine or derivativesalpha-amino acid amiden-acyl-aminecarboxylic acid imidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|