| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:42:42 UTC |
|---|
| Update Date | 2025-03-21 17:59:29 UTC |
|---|
| HMDB ID | HMDB0258867 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00021360 |
|---|
| Name | Tetrac |
|---|
| Frequency | 187.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H8I4O4 |
|---|
| Molecular Mass | 747.6602 |
|---|
| SMILES | O=C(O)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
|---|
| InChI Key | PPJYSSNKSXAVDB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl iodidescarbonyl compoundscarboxylic acidsdiarylethershalophenolshydrocarbon derivativesiodobenzenesmonocarboxylic acids and derivativeso-iodophenolsorganic oxidesorganoiodidesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acidcarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxide2-iodophenolaryl halidearomatic homomonocyclic compound2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativearyl iodidehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
