| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:43 UTC |
|---|
| Update Date | 2025-03-21 17:59:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00021405 |
|---|
| Frequency | 187.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H6O10P2 |
|---|
| Molecular Mass | 263.9436 |
|---|
| SMILES | O=C(COP(=O)(O)O)C(=O)OP(=O)(O)O |
|---|
| InChI Key | LIXBTDFBZACXCK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | glycerone phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatesalpha-keto acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundacyl monophosphatecarboxylic acid derivativeglycerone phosphateorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphateketo acidalpha-keto acidhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateacyl phosphate |
|---|
