Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:42:44 UTC |
---|
Update Date | 2025-03-21 17:59:30 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00021426 |
---|
Frequency | 186.7 |
---|
Structure | |
---|
Chemical Formula | C13H21N3O4S |
---|
Molecular Mass | 315.1253 |
---|
SMILES | O=C(O)CCNC(=O)CCCCC1SCC2NC(=O)NC21 |
---|
InChI Key | KHLNNZMNFAFRMJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | biotin and derivatives |
---|
Subclass | biotin and derivatives |
---|
Direct Parent | biotin and derivatives |
---|
Geometric Descriptor | aliphatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsbeta amino acids and derivativescarbonyl compoundscarboxylic acidsdialkylthioethershydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesn-acyl aminesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidesthienoimidazolidinesthiolanesthiophenes |
---|
Substituents | thiolaneimidazolidinefatty acylcarbonyl groupcarboxylic acidfatty amidethiophenecarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxidebiotin_derivativeorganonitrogen compoundorganopnictogen compoundcarbonic acid derivativeazacycledialkylthioetherthienoimidazolidinecarboxamide groupn-acyl-aminebeta amino acid or derivativessecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|