| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:42:50 UTC |
|---|
| Update Date | 2025-03-21 17:59:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00021665 |
|---|
| Frequency | 347.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11N4O8P |
|---|
| Molecular Mass | 346.0314 |
|---|
| SMILES | O=P1(O)OCC2OC(n3cnc4c(O)nc(O)nc43)C(O)C2O1 |
|---|
| InChI Key | AAUQFLOPCIXUSK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | cyclic purine nucleotides |
|---|
| Direct Parent | 3',5'-cyclic purine nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesimidazolesmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatespurines and purine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | pentose phosphatemonosaccharidehydroxypyrimidineimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compound3',5'-cyclic purine ribonucleotideoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
